C16H22O9 — CID 23232545
[(1R,2S,7R,8S,9R,10S)-2,7-diacetyloxy-10-hydroxy-11,12-dioxatricyclo[7.2.1.02,7]dodecan-8-yl] acetate (PubChem CID 23232545) has the molecular formula C16H22O9 and a molecular weight of 358.34 g/mol. Its IUPAC name is [(1R,2S,7R,8S,9R,10S)-2,7-diacetyloxy-10-hydroxy-11,12-dioxatricyclo[7.2.1.02,7]dodecan-8-yl] acetate.
| Compound Name | [(1R,2S,7R,8S,9R,10S)-2,7-diacetyloxy-10-hydroxy-11,12-dioxatricyclo[7.2.1.02,7]dodecan-8-yl] acetate |
|---|---|
| PubChem CID | 23232545 |
| Molecular Formula | C16H22O9 |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | [(1R,2S,7R,8S,9R,10S)-2,7-diacetyloxy-10-hydroxy-11,12-dioxatricyclo[7.2.1.02,7]dodecan-8-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H]2O[C@H](O[C@@H]2O)[C@]2(OC(C)=O)CCCC[C@@]12OC(C)=O |
| InChI | InChI=1S/C16H22O9/c1-8(17)21-12-11-13(20)23-14(22-11)16(25-10(3)19)7-5-4-6-15(12,16)24-9(2)18/h11-14,20H,4-7H2,1-3H3/t11-,12+,13+,14-,15-,16-/m1/s1 |
| InChIKey | MQMBKCLLHQAAAJ-HIFUNWJGSA-N |
| XLogP | 0.17 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|