C12H18O7 — CID 101385511
[(2S,3R,4R)-4,5-diacetyloxy-2,4-dimethyloxolan-3-yl] acetate (PubChem CID 101385511) has the molecular formula C12H18O7 and a molecular weight of 274.27 g/mol. Its IUPAC name is [(2S,3R,4R)-4,5-diacetyloxy-2,4-dimethyloxolan-3-yl] acetate.
| Compound Name | [(2S,3R,4R)-4,5-diacetyloxy-2,4-dimethyloxolan-3-yl] acetate |
|---|---|
| PubChem CID | 101385511 |
| Molecular Formula | C12H18O7 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | [(2S,3R,4R)-4,5-diacetyloxy-2,4-dimethyloxolan-3-yl] acetate |
| SMILES | CC(=O)OC1O[C@@H](C)[C@@H](OC(C)=O)[C@@]1(C)OC(C)=O |
| InChI | InChI=1S/C12H18O7/c1-6-10(17-7(2)13)12(5,19-9(4)15)11(16-6)18-8(3)14/h6,10-11H,1-5H3/t6-,10+,11?,12+/m0/s1 |
| InChIKey | CCEWIEXRXOPWJL-UEFCUCLOSA-N |
| XLogP | 0.55 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|