C9H14O5 — CID 101230085
[(1S,3S,4S,5S,6S)-5-hydroxy-3,5-dimethyl-2,7-dioxabicyclo[4.1.0]heptan-4-yl] acetate (PubChem CID 101230085) has the molecular formula C9H14O5 and a molecular weight of 202.21 g/mol. Its IUPAC name is [(1S,3S,4S,5S,6S)-5-hydroxy-3,5-dimethyl-2,7-dioxabicyclo[4.1.0]heptan-4-yl] acetate.
| Compound Name | [(1S,3S,4S,5S,6S)-5-hydroxy-3,5-dimethyl-2,7-dioxabicyclo[4.1.0]heptan-4-yl] acetate |
|---|---|
| PubChem CID | 101230085 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | [(1S,3S,4S,5S,6S)-5-hydroxy-3,5-dimethyl-2,7-dioxabicyclo[4.1.0]heptan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](C)O[C@H]2O[C@H]2[C@@]1(C)O |
| InChI | InChI=1S/C9H14O5/c1-4-6(13-5(2)10)9(3,11)7-8(12-4)14-7/h4,6-8,11H,1-3H3/t4-,6-,7+,8-,9-/m0/s1 |
| InChIKey | FKMNUUIHWRBGRC-LOSPZJHSSA-N |
| XLogP | -0.19 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|