C11H15F4NO4 — CID 10828122
[(2S,3R,4R,6S)-6-fluoro-2,4-dimethyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate (PubChem CID 10828122) has the molecular formula C11H15F4NO4 and a molecular weight of 301.24 g/mol. Its IUPAC name is [(2S,3R,4R,6S)-6-fluoro-2,4-dimethyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate.
| Compound Name | [(2S,3R,4R,6S)-6-fluoro-2,4-dimethyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 10828122 |
| Molecular Formula | C11H15F4NO4 |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | [(2S,3R,4R,6S)-6-fluoro-2,4-dimethyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](C)O[C@@H](F)C[C@@]1(C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H15F4NO4/c1-5-8(20-6(2)17)10(3,4-7(12)19-5)16-9(18)11(13,14)15/h5,7-8H,4H2,1-3H3,(H,16,18)/t5-,7+,8-,10+/m0/s1 |
| InChIKey | WONJVILPRZIPBY-LHGNLISDSA-N |
| XLogP | 1.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |