C18H22O4 — CID 58231566
[(2S,3S,3aR,6R,6aR)-2,6-dimethyl-3a-phenylmethoxy-2,3,6,6a-tetrahydrocyclopenta[b]furan-3-yl] acetate (PubChem CID 58231566) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is [(2S,3S,3aR,6R,6aR)-2,6-dimethyl-3a-phenylmethoxy-2,3,6,6a-tetrahydrocyclopenta[b]furan-3-yl] acetate.
| Compound Name | [(2S,3S,3aR,6R,6aR)-2,6-dimethyl-3a-phenylmethoxy-2,3,6,6a-tetrahydrocyclopenta[b]furan-3-yl] acetate |
|---|---|
| PubChem CID | 58231566 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | [(2S,3S,3aR,6R,6aR)-2,6-dimethyl-3a-phenylmethoxy-2,3,6,6a-tetrahydrocyclopenta[b]furan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](C)O[C@@H]2[C@H](C)C=C[C@@]21OCc1ccccc1 |
| InChI | InChI=1S/C18H22O4/c1-12-9-10-18(20-11-15-7-5-4-6-8-15)16(12)21-13(2)17(18)22-14(3)19/h4-10,12-13,16-17H,11H2,1-3H3/t12-,13+,16-,17+,18-/m1/s1 |
| InChIKey | ZWKSWPJCFZPTOL-FRULXJFHSA-N |
| XLogP | 2.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|