C29H42N2O3S — CID 23232654
N-[(E)-[(1R,2S,5S,13S,14S,17R,19R)-17-hydroxy-14-methyl-6-pentacyclo[11.8.0.02,10.05,10.014,19]henicosanylidene]amino]-4-methylbenzenesulfonamide (PubChem CID 23232654) has the molecular formula C29H42N2O3S and a molecular weight of 498.73 g/mol. Its IUPAC name is N-[(E)-[(1R,2S,5S,13S,14S,17R,19R)-17-hydroxy-14-methyl-6-pentacyclo[11.8.0.02,10.05,10.014,19]henicosanylidene]amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-[(1R,2S,5S,13S,14S,17R,19R)-17-hydroxy-14-methyl-6-pentacyclo[11.8.0.02,10.05,10.014,19]henicosanylidene]amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 23232654 |
| Molecular Formula | C29H42N2O3S |
| Molecular Weight | 498.73 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | N-[(E)-[(1R,2S,5S,13S,14S,17R,19R)-17-hydroxy-14-methyl-6-pentacyclo[11.8.0.02,10.05,10.014,19]henicosanylidene]amino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C2\CCCC34CC[C@H]5[C@@H](CC[C@@H]6C[C@H](O)CC[C@@]65C)[C@@H]3CC[C@H]24)cc1 |
| InChI | InChI=1S/C29H42N2O3S/c1-19-5-8-22(9-6-19)35(33,34)31-30-27-4-3-15-29-17-14-24-23(25(29)11-12-26(27)29)10-7-20-18-21(32)13-16-28(20,24)2/h5-6,8-9,20-21,23-26,31-32H,3-4,7,10-18H2,1-2H3/b30-27+/t20-,21-,23-,24+,25+,26-,28+,29?/m1/s1 |
| InChIKey | BMUXEWFSXXVCFY-BOEWUFSJSA-N |
| XLogP | 5.81 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.73 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|