C10H8ClF6NO3 — CID 23236712
ethyl 5-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-3-methyl-1,2-oxazole-4-carboxylate (PubChem CID 23236712) has the molecular formula C10H8ClF6NO3 and a molecular weight of 339.62 g/mol. Its IUPAC name is ethyl 5-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-3-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | ethyl 5-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-3-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 23236712 |
| Molecular Formula | C10H8ClF6NO3 |
| Molecular Weight | 339.62 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | ethyl 5-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-3-methyl-1,2-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C)noc1C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C10H8ClF6NO3/c1-3-20-7(19)5-4(2)18-21-6(5)8(12,13)9(14,15)10(11,16)17/h3H2,1-2H3 |
| InChIKey | KPRCUTXTPWUAAB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.62 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|