C9H10BrF2NO3 — CID 23236714
ethyl 5-[bromo(difluoro)methyl]-3-ethyl-1,2-oxazole-4-carboxylate (PubChem CID 23236714) has the molecular formula C9H10BrF2NO3 and a molecular weight of 298.08 g/mol. Its IUPAC name is ethyl 5-[bromo(difluoro)methyl]-3-ethyl-1,2-oxazole-4-carboxylate.
| Compound Name | ethyl 5-[bromo(difluoro)methyl]-3-ethyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 23236714 |
| Molecular Formula | C9H10BrF2NO3 |
| Molecular Weight | 298.08 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | ethyl 5-[bromo(difluoro)methyl]-3-ethyl-1,2-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(CC)noc1C(F)(F)Br |
| InChI | InChI=1S/C9H10BrF2NO3/c1-3-5-6(8(14)15-4-2)7(16-13-5)9(10,11)12/h3-4H2,1-2H3 |
| InChIKey | HXECYISNOLUCGY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.08 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|