C34H22F7NO6S — CID 23236984
ethyl (3R)-2,2-difluoro-3-[(4S)-2-oxo-3-(9-phenylfluoren-9-yl)-1,3-oxazolidin-4-yl]-3-(2,3,4,5,6-pentafluorophenoxy)carbothioyloxypropanoate (PubChem CID 23236984) has the molecular formula C34H22F7NO6S and a molecular weight of 705.60 g/mol. Its IUPAC name is ethyl (3R)-2,2-difluoro-3-[(4S)-2-oxo-3-(9-phenylfluoren-9-yl)-1,3-oxazolidin-4-yl]-3-(2,3,4,5,6-pentafluorophenoxy)carbothioyloxypropanoate.
| Compound Name | ethyl (3R)-2,2-difluoro-3-[(4S)-2-oxo-3-(9-phenylfluoren-9-yl)-1,3-oxazolidin-4-yl]-3-(2,3,4,5,6-pentafluorophenoxy)carbothioyloxypropanoate |
|---|---|
| PubChem CID | 23236984 |
| Molecular Formula | C34H22F7NO6S |
| Molecular Weight | 705.60 g/mol |
| Exact Mass | 705.11 |
| IUPAC Name | ethyl (3R)-2,2-difluoro-3-[(4S)-2-oxo-3-(9-phenylfluoren-9-yl)-1,3-oxazolidin-4-yl]-3-(2,3,4,5,6-pentafluorophenoxy)carbothioyloxypropanoate |
| SMILES | CCOC(=O)C(F)(F)[C@H](OC(=S)Oc1c(F)c(F)c(F)c(F)c1F)[C@@H]1COC(=O)N1C1(c2ccccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C34H22F7NO6S/c1-2-45-30(43)34(40,41)29(48-32(49)47-28-26(38)24(36)23(35)25(37)27(28)39)22-16-46-31(44)42(22)33(17-10-4-3-5-11-17)20-14-8-6-12-18(20)19-13-7-9-15-21(19)33/h3-15,22,29H,2,16H2,1H3/t22-,29+/m0/s1 |
| InChIKey | YNOAWNBSDHYHOL-PZGXJGMVSA-N |
| XLogP | 7.42 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.60 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|