C10H12F3NO3 — CID 23237341
ethyl 4,4,4-trifluoro-3-hydroxy-3-(1H-pyrrol-2-yl)butanoate (PubChem CID 23237341) has the molecular formula C10H12F3NO3 and a molecular weight of 251.20 g/mol. Its IUPAC name is ethyl 4,4,4-trifluoro-3-hydroxy-3-(1H-pyrrol-2-yl)butanoate.
| Compound Name | ethyl 4,4,4-trifluoro-3-hydroxy-3-(1H-pyrrol-2-yl)butanoate |
|---|---|
| PubChem CID | 23237341 |
| Molecular Formula | C10H12F3NO3 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | ethyl 4,4,4-trifluoro-3-hydroxy-3-(1H-pyrrol-2-yl)butanoate |
| SMILES | CCOC(=O)CC(O)(c1ccc[nH]1)C(F)(F)F |
| InChI | InChI=1S/C10H12F3NO3/c1-2-17-8(15)6-9(16,10(11,12)13)7-4-3-5-14-7/h3-5,14,16H,2,6H2,1H3 |
| InChIKey | MLWNIZLFGXOZEU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |