C20H31N5O14P2-2 — CID 23238641
[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2R,3S,4R,5R)-3,4-dihydroxy-5-pentoxyoxolan-2-yl]methyl phosphate (PubChem CID 23238641) has the molecular formula C20H31N5O14P2-2 and a molecular weight of 627.44 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2R,3S,4R,5R)-3,4-dihydroxy-5-pentoxyoxolan-2-yl]methyl phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2R,3S,4R,5R)-3,4-dihydroxy-5-pentoxyoxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 23238641 |
| Molecular Formula | C20H31N5O14P2-2 |
| Molecular Weight | 627.44 g/mol |
| Exact Mass | 627.14 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2R,3S,4R,5R)-3,4-dihydroxy-5-pentoxyoxolan-2-yl]methyl phosphate |
| SMILES | CCCCCO[C@@H]1O[C@H](COP(=O)([O-])OP(=O)([O-])OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H33N5O14P2/c1-2-3-4-5-34-20-16(29)14(27)11(38-20)7-36-41(32,33)39-40(30,31)35-6-10-13(26)15(28)19(37-10)25-9-24-12-17(21)22-8-23-18(12)25/h8-11,13-16,19-20,26-29H,2-7H2,1H3,(H,30,31)(H,32,33)(H2,21,22,23)/p-2/t10-,11-,13-,14-,15-,16-,19-,20-/m1/s1 |
| InChIKey | KGUGBIMNGLZEIW-HISDBWNOSA-L |
| XLogP | -2.33 |
| TPSA | 286.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.44 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|