C32H31FN4O — CID 2323868
4-tert-butyl-N-[3-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-1-phenylpyrazol-5-yl]benzamide (PubChem CID 2323868) has the molecular formula C32H31FN4O and a molecular weight of 506.63 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-1-phenylpyrazol-5-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-1-phenylpyrazol-5-yl]benzamide |
|---|---|
| PubChem CID | 2323868 |
| Molecular Formula | C32H31FN4O |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | 4-tert-butyl-N-[3-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-1-phenylpyrazol-5-yl]benzamide |
| SMILES | Cc1cc(-c2cc(NC(=O)c3ccc(C(C)(C)C)cc3)n(-c3ccccc3)n2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C32H31FN4O/c1-21-19-28(22(2)36(21)26-17-15-25(33)16-18-26)29-20-30(37(35-29)27-9-7-6-8-10-27)34-31(38)23-11-13-24(14-12-23)32(3,4)5/h6-20H,1-5H3,(H,34,38) |
| InChIKey | CGEPISLEZVJGOZ-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|