C29H23ClFN5OS — CID 2324540
4-chloro-N-[[3-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-1-phenylpyrazol-5-yl]carbamothioyl]benzamide (PubChem CID 2324540) has the molecular formula C29H23ClFN5OS and a molecular weight of 544.06 g/mol. Its IUPAC name is 4-chloro-N-[[3-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-1-phenylpyrazol-5-yl]carbamothioyl]benzamide.
| Compound Name | 4-chloro-N-[[3-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-1-phenylpyrazol-5-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 2324540 |
| Molecular Formula | C29H23ClFN5OS |
| Molecular Weight | 544.06 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | 4-chloro-N-[[3-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-1-phenylpyrazol-5-yl]carbamothioyl]benzamide |
| SMILES | Cc1cc(-c2cc(NC(=S)NC(=O)c3ccc(Cl)cc3)n(-c3ccccc3)n2)c(C)n1-c1ccccc1F |
| InChI | InChI=1S/C29H23ClFN5OS/c1-18-16-23(19(2)35(18)26-11-7-6-10-24(26)31)25-17-27(36(34-25)22-8-4-3-5-9-22)32-29(38)33-28(37)20-12-14-21(30)15-13-20/h3-17H,1-2H3,(H2,32,33,37,38) |
| InChIKey | SHTPJHFYGMKQEL-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 63.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.06 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|