C16H21N — CID 23239104
2-[(2Z,5Z)-cycloocta-2,5-dien-1-yl]-3,6-dimethylaniline (PubChem CID 23239104) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 2-[(2Z,5Z)-cycloocta-2,5-dien-1-yl]-3,6-dimethylaniline.
| Compound Name | 2-[(2Z,5Z)-cycloocta-2,5-dien-1-yl]-3,6-dimethylaniline |
|---|---|
| PubChem CID | 23239104 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 2-[(2Z,5Z)-cycloocta-2,5-dien-1-yl]-3,6-dimethylaniline |
| SMILES | Cc1ccc(C)c(C2/C=C\C/C=C\CC2)c1N |
| InChI | InChI=1S/C16H21N/c1-12-10-11-13(2)16(17)15(12)14-8-6-4-3-5-7-9-14/h3-4,7,9-11,14H,5-6,8,17H2,1-2H3/b4-3-,9-7- |
| InChIKey | AUTPTXSNXHCSKD-DDYVKQNKSA-N |
| XLogP | 4.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|