C10H14Cl3NO3 — CID 23239290
N-[(Z)-7,7,7-trichloro-6-hydroxy-2-methyl-4-oxohept-5-en-2-yl]acetamide (PubChem CID 23239290) has the molecular formula C10H14Cl3NO3 and a molecular weight of 302.59 g/mol. Its IUPAC name is N-[(Z)-7,7,7-trichloro-6-hydroxy-2-methyl-4-oxohept-5-en-2-yl]acetamide.
| Compound Name | N-[(Z)-7,7,7-trichloro-6-hydroxy-2-methyl-4-oxohept-5-en-2-yl]acetamide |
|---|---|
| PubChem CID | 23239290 |
| Molecular Formula | C10H14Cl3NO3 |
| Molecular Weight | 302.59 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | N-[(Z)-7,7,7-trichloro-6-hydroxy-2-methyl-4-oxohept-5-en-2-yl]acetamide |
| SMILES | CC(=O)NC(C)(C)CC(=O)/C=C(\O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H14Cl3NO3/c1-6(15)14-9(2,3)5-7(16)4-8(17)10(11,12)13/h4,17H,5H2,1-3H3,(H,14,15)/b8-4- |
| InChIKey | RUPDJVBXJISQIM-YWEYNIOJSA-N |
| XLogP | 2.67 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.59 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|