C15H22O6 — CID 23239548
diethyl 2-[(2E)-4-acetyloxy-3-methylpenta-2,4-dienyl]propanedioate (PubChem CID 23239548) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is diethyl 2-[(2E)-4-acetyloxy-3-methylpenta-2,4-dienyl]propanedioate.
| Compound Name | diethyl 2-[(2E)-4-acetyloxy-3-methylpenta-2,4-dienyl]propanedioate |
|---|---|
| PubChem CID | 23239548 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | diethyl 2-[(2E)-4-acetyloxy-3-methylpenta-2,4-dienyl]propanedioate |
| SMILES | C=C(OC(C)=O)/C(C)=C/CC(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C15H22O6/c1-6-19-14(17)13(15(18)20-7-2)9-8-10(3)11(4)21-12(5)16/h8,13H,4,6-7,9H2,1-3,5H3/b10-8+ |
| InChIKey | FRAXMAVSBAJFFL-CSKARUKUSA-N |
| XLogP | 2.14 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|