C14H12Cl2S — CID 23240286
1-[(1R,3R)-2,2-dichloro-3-methylcyclopropyl]sulfanylnaphthalene (PubChem CID 23240286) has the molecular formula C14H12Cl2S and a molecular weight of 283.22 g/mol. Its IUPAC name is 1-[(1R,3R)-2,2-dichloro-3-methylcyclopropyl]sulfanylnaphthalene.
| Compound Name | 1-[(1R,3R)-2,2-dichloro-3-methylcyclopropyl]sulfanylnaphthalene |
|---|---|
| PubChem CID | 23240286 |
| Molecular Formula | C14H12Cl2S |
| Molecular Weight | 283.22 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 1-[(1R,3R)-2,2-dichloro-3-methylcyclopropyl]sulfanylnaphthalene |
| SMILES | C[C@@H]1[C@@H](Sc2cccc3ccccc23)C1(Cl)Cl |
| InChI | InChI=1S/C14H12Cl2S/c1-9-13(14(9,15)16)17-12-8-4-6-10-5-2-3-7-11(10)12/h2-9,13H,1H3/t9-,13-/m1/s1 |
| InChIKey | JCLVCZSSCBZGRV-NOZJJQNGSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.22 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|