C18H29ClO2 — CID 23240325
[(2E,6E)-10-chloro-3,7,11-trimethyldodeca-2,6,11-trienyl] propanoate (PubChem CID 23240325) has the molecular formula C18H29ClO2 and a molecular weight of 312.88 g/mol. Its IUPAC name is [(2E,6E)-10-chloro-3,7,11-trimethyldodeca-2,6,11-trienyl] propanoate.
| Compound Name | [(2E,6E)-10-chloro-3,7,11-trimethyldodeca-2,6,11-trienyl] propanoate |
|---|---|
| PubChem CID | 23240325 |
| Molecular Formula | C18H29ClO2 |
| Molecular Weight | 312.88 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | [(2E,6E)-10-chloro-3,7,11-trimethyldodeca-2,6,11-trienyl] propanoate |
| SMILES | C=C(C)C(Cl)CC/C(C)=C/CC/C(C)=C/COC(=O)CC |
| InChI | InChI=1S/C18H29ClO2/c1-6-18(20)21-13-12-16(5)9-7-8-15(4)10-11-17(19)14(2)3/h8,12,17H,2,6-7,9-11,13H2,1,3-5H3/b15-8+,16-12+ |
| InChIKey | LVYZJAPPRARFRR-HLETWVSPSA-N |
| XLogP | 5.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.88 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|