C13H20O3 — CID 23241129
[3-(diethoxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methanol (PubChem CID 23241129) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is [3-(diethoxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methanol.
| Compound Name | [3-(diethoxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methanol |
|---|---|
| PubChem CID | 23241129 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | [3-(diethoxymethyl)-2-bicyclo[2.2.1]hepta-2,5-dienyl]methanol |
| SMILES | CCOC(OCC)C1=C(CO)C2C=CC1C2 |
| InChI | InChI=1S/C13H20O3/c1-3-15-13(16-4-2)12-10-6-5-9(7-10)11(12)8-14/h5-6,9-10,13-14H,3-4,7-8H2,1-2H3 |
| InChIKey | UZSWGGLSRLIDLQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|