C14H23FO4 — CID 23242478
(3E)-3-fluoro-4-(2-methoxyethoxymethoxy)-5-prop-2-enoxyhepta-1,3-diene (PubChem CID 23242478) has the molecular formula C14H23FO4 and a molecular weight of 274.33 g/mol. Its IUPAC name is (3E)-3-fluoro-4-(2-methoxyethoxymethoxy)-5-prop-2-enoxyhepta-1,3-diene.
| Compound Name | (3E)-3-fluoro-4-(2-methoxyethoxymethoxy)-5-prop-2-enoxyhepta-1,3-diene |
|---|---|
| PubChem CID | 23242478 |
| Molecular Formula | C14H23FO4 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (3E)-3-fluoro-4-(2-methoxyethoxymethoxy)-5-prop-2-enoxyhepta-1,3-diene |
| SMILES | C=CCOC(CC)/C(OCOCCOC)=C(\F)C=C |
| InChI | InChI=1S/C14H23FO4/c1-5-8-18-13(7-3)14(12(15)6-2)19-11-17-10-9-16-4/h5-6,13H,1-2,7-11H2,3-4H3/b14-12+ |
| InChIKey | NHRDIJXKCMNHPT-WYMLVPIESA-N |
| XLogP | 2.97 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|