C13H18O4 — CID 57252083
6-[3,4-dihydro-2H-pyran-2-yloxy(ethoxy)methyl]-2H-pyran (PubChem CID 57252083) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 6-[3,4-dihydro-2H-pyran-2-yloxy(ethoxy)methyl]-2H-pyran.
| Compound Name | 6-[3,4-dihydro-2H-pyran-2-yloxy(ethoxy)methyl]-2H-pyran |
|---|---|
| PubChem CID | 57252083 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 6-[3,4-dihydro-2H-pyran-2-yloxy(ethoxy)methyl]-2H-pyran |
| SMILES | CCOC(OC1CCC=CO1)C1=CC=CCO1 |
| InChI | InChI=1S/C13H18O4/c1-2-14-13(11-7-3-5-9-15-11)17-12-8-4-6-10-16-12/h3,5-7,10,12-13H,2,4,8-9H2,1H3 |
| InChIKey | TZMCFMAZHZMDAG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|