C12H22O3 — CID 123633479
3-(2,2-diethoxyethoxy)hexa-2,4-diene (PubChem CID 123633479) has the molecular formula C12H22O3 and a molecular weight of 214.31 g/mol. Its IUPAC name is 3-(2,2-diethoxyethoxy)hexa-2,4-diene.
| Compound Name | 3-(2,2-diethoxyethoxy)hexa-2,4-diene |
|---|---|
| PubChem CID | 123633479 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 3-(2,2-diethoxyethoxy)hexa-2,4-diene |
| SMILES | CC=CC(=CC)OCC(OCC)OCC |
| InChI | InChI=1S/C12H22O3/c1-5-9-11(6-2)15-10-12(13-7-3)14-8-4/h5-6,9,12H,7-8,10H2,1-4H3 |
| InChIKey | CUETVZGOEJFEAG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|