About 3-(2,2-diethoxyethoxy)hexa-2,4-diene
3-(2,2-diethoxyethoxy)hexa-2,4-diene (PubChem CID 123633479) has the molecular formula C12H22O3
and a molecular weight of 214.31 g/mol. Its IUPAC name is 3-(2,2-diethoxyethoxy)hexa-2,4-diene.
Molecular Properties
| Compound Name | 3-(2,2-diethoxyethoxy)hexa-2,4-diene |
| PubChem CID | 123633479 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 3-(2,2-diethoxyethoxy)hexa-2,4-diene |
| SMILES | CC=CC(=CC)OCC(OCC)OCC |
| InChI | InChI=1S/C12H22O3/c1-5-9-11(6-2)15-10-12(13-7-3)14-8-4/h5-6,9,12H,7-8,10H2,1-4H3 |
| InChIKey | CUETVZGOEJFEAG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,2-diethoxyethoxy)hexa-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-diethoxyethoxy)hexa-2,4-diene?
The IUPAC name of 3-(2,2-diethoxyethoxy)hexa-2,4-diene (CID 123633479) is 3-(2,2-diethoxyethoxy)hexa-2,4-diene.
What is the SMILES notation for 3-(2,2-diethoxyethoxy)hexa-2,4-diene?
The canonical SMILES for 3-(2,2-diethoxyethoxy)hexa-2,4-diene is CC=CC(=CC)OCC(OCC)OCC.
What is the InChIKey of 3-(2,2-diethoxyethoxy)hexa-2,4-diene?
The InChIKey is CUETVZGOEJFEAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3/c1-5-9-11(6-2)15-10-12(13-7-3)14-8-4/h5-6,9,12H,7-8,10H2,1-4H3.
What are the key properties of 3-(2,2-diethoxyethoxy)hexa-2,4-diene?
3-(2,2-diethoxyethoxy)hexa-2,4-diene has a molecular weight of 214.31 g/mol, XLogP of 2.88, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-diethoxyethoxy)hexa-2,4-diene is sourced from PubChem (CID 123633479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).