C19H26O7 — CID 58935153
(9S)-2,4,6,8,15,18,21-heptaoxatricyclo[20.4.0.09,14]hexacosa-1(26),10,12,22-tetraene (PubChem CID 58935153) has the molecular formula C19H26O7 and a molecular weight of 366.41 g/mol. Its IUPAC name is (9S)-2,4,6,8,15,18,21-heptaoxatricyclo[20.4.0.09,14]hexacosa-1(26),10,12,22-tetraene.
| Compound Name | (9S)-2,4,6,8,15,18,21-heptaoxatricyclo[20.4.0.09,14]hexacosa-1(26),10,12,22-tetraene |
|---|---|
| PubChem CID | 58935153 |
| Molecular Formula | C19H26O7 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (9S)-2,4,6,8,15,18,21-heptaoxatricyclo[20.4.0.09,14]hexacosa-1(26),10,12,22-tetraene |
| SMILES | C1=CC2OCCOCCOC3=CCCC=C3OCOCOCO[C@H]2C=C1 |
| InChI | InChI=1S/C19H26O7/c1-3-7-18-16(5-1)23-11-9-20-10-12-24-17-6-2-4-8-19(17)26-15-22-13-21-14-25-18/h1,3,5-8,16,18H,2,4,9-15H2/t16?,18-/m0/s1 |
| InChIKey | PNOHZPDGURRSKH-DAFXYXGESA-N |
| XLogP | 2.41 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |