C10H16O4 — CID 164671074
(6R)-2,6-bis(methoxymethoxy)cyclohexa-1,3-diene (PubChem CID 164671074) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is (6R)-2,6-bis(methoxymethoxy)cyclohexa-1,3-diene.
| Compound Name | (6R)-2,6-bis(methoxymethoxy)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 164671074 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (6R)-2,6-bis(methoxymethoxy)cyclohexa-1,3-diene |
| SMILES | COCOC1=C[C@H](OCOC)CC=C1 |
| InChI | InChI=1S/C10H16O4/c1-11-7-13-9-4-3-5-10(6-9)14-8-12-2/h3-4,6,10H,5,7-8H2,1-2H3/t10-/m1/s1 |
| InChIKey | GLTHGSAGSACWEU-SNVBAGLBSA-N |
| XLogP | 1.44 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|