C23H19ClNO2P — CID 2324335
N-[(4-chlorophenyl)methyl]-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine (PubChem CID 2324335) has the molecular formula C23H19ClNO2P and a molecular weight of 407.84 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine.
| Compound Name | N-[(4-chlorophenyl)methyl]-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine |
|---|---|
| PubChem CID | 2324335 |
| Molecular Formula | C23H19ClNO2P |
| Molecular Weight | 407.84 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine |
| SMILES | O=P1(NCc2ccc(Cl)cc2)C=C(c2ccccc2)OC(c2ccccc2)=C1 |
| InChI | InChI=1S/C23H19ClNO2P/c24-21-13-11-18(12-14-21)15-25-28(26)16-22(19-7-3-1-4-8-19)27-23(17-28)20-9-5-2-6-10-20/h1-14,16-17H,15H2,(H,25,26) |
| InChIKey | NQYRESCDJIUBEG-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.84 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|