C44H52N2O13 — CID 23245311
1-O-[[(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[6-(9H-fluoren-9-ylmethoxycarbonylamino)hexoxy]oxan-2-yl]methyl] 4-O-benzyl butanedioate (PubChem CID 23245311) has the molecular formula C44H52N2O13 and a molecular weight of 816.90 g/mol. Its IUPAC name is 1-O-[[(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[6-(9H-fluoren-9-ylmethoxycarbonylamino)hexoxy]oxan-2-yl]methyl] 4-O-benzyl butanedioate.
| Compound Name | 1-O-[[(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[6-(9H-fluoren-9-ylmethoxycarbonylamino)hexoxy]oxan-2-yl]methyl] 4-O-benzyl butanedioate |
|---|---|
| PubChem CID | 23245311 |
| Molecular Formula | C44H52N2O13 |
| Molecular Weight | 816.90 g/mol |
| Exact Mass | 816.35 |
| IUPAC Name | 1-O-[[(2R,3R,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[6-(9H-fluoren-9-ylmethoxycarbonylamino)hexoxy]oxan-2-yl]methyl] 4-O-benzyl butanedioate |
| SMILES | CC(=O)N[C@H]1[C@H](OCCCCCCNC(=O)OCC2c3ccccc3-c3ccccc32)O[C@H](COC(=O)CCC(=O)OCc2ccccc2)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C44H52N2O13/c1-28(47)46-40-42(58-30(3)49)41(57-29(2)48)37(27-55-39(51)22-21-38(50)54-25-31-15-7-6-8-16-31)59-43(40)53-24-14-5-4-13-23-45-44(52)56-26-36-34-19-11-9-17-32(34)33-18-10-12-20-35(33)36/h6-12,15-20,36-37,40-43H,4-5,13-14,21-27H2,1-3H3,(H,45,52)(H,46,47)/t37-,40-,41+,42-,43-/m1/s1 |
| InChIKey | SOMIBGJAICOARV-CMLDBIBSSA-N |
| XLogP | 5.26 |
| TPSA | 191.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.90 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|