C19H36O5Si — CID 23245523
[(1R,3R,5R)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohexyl] 2,2-dimethylpropanoate (PubChem CID 23245523) has the molecular formula C19H36O5Si and a molecular weight of 372.58 g/mol. Its IUPAC name is [(1R,3R,5R)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohexyl] 2,2-dimethylpropanoate.
| Compound Name | [(1R,3R,5R)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohexyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 23245523 |
| Molecular Formula | C19H36O5Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | [(1R,3R,5R)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohexyl] 2,2-dimethylpropanoate |
| SMILES | CC(=O)O[C@@H]1C[C@@H](OC(=O)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C19H36O5Si/c1-13(20)22-14-10-15(23-17(21)18(2,3)4)12-16(11-14)24-25(8,9)19(5,6)7/h14-16H,10-12H2,1-9H3/t14-,15-,16-/m1/s1 |
| InChIKey | VXVXQWRXOPWEEA-BZUAXINKSA-N |
| XLogP | 4.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|