C16H30O5Si — CID 10314601
[(1R,3S)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohexyl] acetate (PubChem CID 10314601) has the molecular formula C16H30O5Si and a molecular weight of 330.50 g/mol. Its IUPAC name is [(1R,3S)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohexyl] acetate.
| Compound Name | [(1R,3S)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohexyl] acetate |
|---|---|
| PubChem CID | 10314601 |
| Molecular Formula | C16H30O5Si |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | [(1R,3S)-3-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1CC(O[Si](C)(C)C(C)(C)C)C[C@H](OC(C)=O)C1 |
| InChI | InChI=1S/C16H30O5Si/c1-11(17)19-13-8-14(20-12(2)18)10-15(9-13)21-22(6,7)16(3,4)5/h13-15H,8-10H2,1-7H3/t13-,14+,15? |
| InChIKey | QTMOPNNKKFVITK-YIONKMFJSA-N |
| XLogP | 3.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|