C19H36O5Si — CID 10872406
[(1S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(oxan-2-yloxy)cyclohexyl] acetate (PubChem CID 10872406) has the molecular formula C19H36O5Si and a molecular weight of 372.58 g/mol. Its IUPAC name is [(1S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(oxan-2-yloxy)cyclohexyl] acetate.
| Compound Name | [(1S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(oxan-2-yloxy)cyclohexyl] acetate |
|---|---|
| PubChem CID | 10872406 |
| Molecular Formula | C19H36O5Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | [(1S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(oxan-2-yloxy)cyclohexyl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H](OC2CCCCO2)C[C@@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C19H36O5Si/c1-14(20)22-15-11-16(23-18-9-7-8-10-21-18)13-17(12-15)24-25(5,6)19(2,3)4/h15-18H,7-13H2,1-6H3/t15-,16+,17-,18?/m0/s1 |
| InChIKey | ZBJILLGVFALJHA-KTGAGVNESA-N |
| XLogP | 4.40 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|