C14H9Br3N2O5 — CID 23246712
[(E)-(3,5,6-tribromo-6-methyl-4-oxocyclohex-2-en-1-ylidene)amino] 4-nitrobenzoate (PubChem CID 23246712) has the molecular formula C14H9Br3N2O5 and a molecular weight of 524.95 g/mol. Its IUPAC name is [(E)-(3,5,6-tribromo-6-methyl-4-oxocyclohex-2-en-1-ylidene)amino] 4-nitrobenzoate.
| Compound Name | [(E)-(3,5,6-tribromo-6-methyl-4-oxocyclohex-2-en-1-ylidene)amino] 4-nitrobenzoate |
|---|---|
| PubChem CID | 23246712 |
| Molecular Formula | C14H9Br3N2O5 |
| Molecular Weight | 524.95 g/mol |
| Exact Mass | 521.81 |
| IUPAC Name | [(E)-(3,5,6-tribromo-6-methyl-4-oxocyclohex-2-en-1-ylidene)amino] 4-nitrobenzoate |
| SMILES | CC1(Br)/C(=N/OC(=O)c2ccc([N+](=O)[O-])cc2)C=C(Br)C(=O)C1Br |
| InChI | InChI=1S/C14H9Br3N2O5/c1-14(17)10(6-9(15)11(20)12(14)16)18-24-13(21)7-2-4-8(5-3-7)19(22)23/h2-6,12H,1H3/b18-10+ |
| InChIKey | AUNCWXBDPKNNTA-VCHYOVAHSA-N |
| XLogP | 3.89 |
| TPSA | 98.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.95 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|