C15H11Cl3N2O5 — CID 74027991
[(5,5,6-trichloro-2,3-dimethyl-4-oxocyclohex-2-en-1-ylidene)amino] 4-nitrobenzoate (PubChem CID 74027991) has the molecular formula C15H11Cl3N2O5 and a molecular weight of 405.62 g/mol. Its IUPAC name is [(5,5,6-trichloro-2,3-dimethyl-4-oxocyclohex-2-en-1-ylidene)amino] 4-nitrobenzoate.
| Compound Name | [(5,5,6-trichloro-2,3-dimethyl-4-oxocyclohex-2-en-1-ylidene)amino] 4-nitrobenzoate |
|---|---|
| PubChem CID | 74027991 |
| Molecular Formula | C15H11Cl3N2O5 |
| Molecular Weight | 405.62 g/mol |
| Exact Mass | 403.97 |
| IUPAC Name | [(5,5,6-trichloro-2,3-dimethyl-4-oxocyclohex-2-en-1-ylidene)amino] 4-nitrobenzoate |
| SMILES | CC1=C(C)C(=NOC(=O)c2ccc([N+](=O)[O-])cc2)C(Cl)C(Cl)(Cl)C1=O |
| InChI | InChI=1S/C15H11Cl3N2O5/c1-7-8(2)13(21)15(17,18)12(16)11(7)19-25-14(22)9-3-5-10(6-4-9)20(23)24/h3-6,12H,1-2H3 |
| InChIKey | NCYBSIKWXMSJIW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 98.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.62 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|