C17H14Cl4N2O4 — CID 34071941
N-[(5R,6S)-5-tert-butyl-2,3,5,6-tetrachloro-4-oxocyclohex-2-en-1-ylidene]-4-nitrobenzamide (PubChem CID 34071941) has the molecular formula C17H14Cl4N2O4 and a molecular weight of 452.12 g/mol. Its IUPAC name is N-[(5R,6S)-5-tert-butyl-2,3,5,6-tetrachloro-4-oxocyclohex-2-en-1-ylidene]-4-nitrobenzamide.
| Compound Name | N-[(5R,6S)-5-tert-butyl-2,3,5,6-tetrachloro-4-oxocyclohex-2-en-1-ylidene]-4-nitrobenzamide |
|---|---|
| PubChem CID | 34071941 |
| Molecular Formula | C17H14Cl4N2O4 |
| Molecular Weight | 452.12 g/mol |
| Exact Mass | 449.97 |
| IUPAC Name | N-[(5R,6S)-5-tert-butyl-2,3,5,6-tetrachloro-4-oxocyclohex-2-en-1-ylidene]-4-nitrobenzamide |
| SMILES | CC(C)(C)[C@@]1(Cl)C(=O)C(Cl)=C(Cl)/C(=N\C(=O)c2ccc([N+](=O)[O-])cc2)[C@@H]1Cl |
| InChI | InChI=1S/C17H14Cl4N2O4/c1-16(2,3)17(21)13(20)12(10(18)11(19)14(17)24)22-15(25)8-4-6-9(7-5-8)23(26)27/h4-7,13H,1-3H3/b22-12+/t13-,17-/m0/s1 |
| InChIKey | WEAZOAIXOCOVEX-RIADISFTSA-N |
| XLogP | 5.08 |
| TPSA | 89.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.12 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|