C13H4Cl4N2O4 — CID 2326278
4-nitro-N-(2,3,5,6-tetrachloro-4-oxocyclohexa-2,5-dien-1-ylidene)benzamide (PubChem CID 2326278) has the molecular formula C13H4Cl4N2O4 and a molecular weight of 394.00 g/mol. Its IUPAC name is 4-nitro-N-(2,3,5,6-tetrachloro-4-oxocyclohexa-2,5-dien-1-ylidene)benzamide.
| Compound Name | 4-nitro-N-(2,3,5,6-tetrachloro-4-oxocyclohexa-2,5-dien-1-ylidene)benzamide |
|---|---|
| PubChem CID | 2326278 |
| Molecular Formula | C13H4Cl4N2O4 |
| Molecular Weight | 394.00 g/mol |
| Exact Mass | 391.89 |
| IUPAC Name | 4-nitro-N-(2,3,5,6-tetrachloro-4-oxocyclohexa-2,5-dien-1-ylidene)benzamide |
| SMILES | O=C1C(Cl)=C(Cl)C(=NC(=O)c2ccc([N+](=O)[O-])cc2)C(Cl)=C1Cl |
| InChI | InChI=1S/C13H4Cl4N2O4/c14-7-9(16)12(20)10(17)8(15)11(7)18-13(21)5-1-3-6(4-2-5)19(22)23/h1-4H |
| InChIKey | RVFCKRJNPNWTQQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 89.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.00 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|