C26H38O3 — CID 23247027
[(1R,2R,3S,4R)-3-[(4-methoxyphenyl)methyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (2S)-2-cyclopentylpropanoate (PubChem CID 23247027) has the molecular formula C26H38O3 and a molecular weight of 398.59 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-3-[(4-methoxyphenyl)methyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (2S)-2-cyclopentylpropanoate.
| Compound Name | [(1R,2R,3S,4R)-3-[(4-methoxyphenyl)methyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (2S)-2-cyclopentylpropanoate |
|---|---|
| PubChem CID | 23247027 |
| Molecular Formula | C26H38O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | [(1R,2R,3S,4R)-3-[(4-methoxyphenyl)methyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (2S)-2-cyclopentylpropanoate |
| SMILES | COc1ccc(C[C@H]2[C@H]3CC[C@@](C)([C@@H]2OC(=O)[C@@H](C)C2CCCC2)C3(C)C)cc1 |
| InChI | InChI=1S/C26H38O3/c1-17(19-8-6-7-9-19)24(27)29-23-21(16-18-10-12-20(28-5)13-11-18)22-14-15-26(23,4)25(22,2)3/h10-13,17,19,21-23H,6-9,14-16H2,1-5H3/t17-,21-,22+,23+,26-/m0/s1 |
| InChIKey | LEPDNSUTBHPSPC-UFVGYYCFSA-N |
| XLogP | 6.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |