C25H36O3 — CID 102271351
[(1R,2R,3S,4R)-3-[(4-methoxyphenyl)methyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (2S)-2,4-dimethylpent-4-enoate (PubChem CID 102271351) has the molecular formula C25H36O3 and a molecular weight of 384.56 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-3-[(4-methoxyphenyl)methyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (2S)-2,4-dimethylpent-4-enoate.
| Compound Name | [(1R,2R,3S,4R)-3-[(4-methoxyphenyl)methyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (2S)-2,4-dimethylpent-4-enoate |
|---|---|
| PubChem CID | 102271351 |
| Molecular Formula | C25H36O3 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | [(1R,2R,3S,4R)-3-[(4-methoxyphenyl)methyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (2S)-2,4-dimethylpent-4-enoate |
| SMILES | C=C(C)C[C@H](C)C(=O)O[C@@H]1[C@@H](Cc2ccc(OC)cc2)[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C25H36O3/c1-16(2)14-17(3)23(26)28-22-20(15-18-8-10-19(27-7)11-9-18)21-12-13-25(22,6)24(21,4)5/h8-11,17,20-22H,1,12-15H2,2-7H3/t17-,20-,21+,22+,25-/m0/s1 |
| InChIKey | HPFGSSBRSIEQKS-OYGHRNHJSA-N |
| XLogP | 5.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|