C21H30O7 — CID 23247588
[(1S,3R,9S,13R,17R)-1-methyl-5,11,14-trioxo-9-propan-2-yl-4,16-dioxatricyclo[11.2.1.13,6]heptadecan-17-yl] acetate (PubChem CID 23247588) has the molecular formula C21H30O7 and a molecular weight of 394.46 g/mol. Its IUPAC name is [(1S,3R,9S,13R,17R)-1-methyl-5,11,14-trioxo-9-propan-2-yl-4,16-dioxatricyclo[11.2.1.13,6]heptadecan-17-yl] acetate.
| Compound Name | [(1S,3R,9S,13R,17R)-1-methyl-5,11,14-trioxo-9-propan-2-yl-4,16-dioxatricyclo[11.2.1.13,6]heptadecan-17-yl] acetate |
|---|---|
| PubChem CID | 23247588 |
| Molecular Formula | C21H30O7 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | [(1S,3R,9S,13R,17R)-1-methyl-5,11,14-trioxo-9-propan-2-yl-4,16-dioxatricyclo[11.2.1.13,6]heptadecan-17-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C2CC[C@H](C(C)C)CC(=O)C[C@H]3O[C@](C)(CC3=O)C[C@H]1OC2=O |
| InChI | InChI=1S/C21H30O7/c1-11(2)13-5-6-15-19(26-12(3)22)18(27-20(15)25)10-21(4)9-16(24)17(28-21)8-14(23)7-13/h11,13,15,17-19H,5-10H2,1-4H3/t13-,15?,17+,18+,19+,21+/m0/s1 |
| InChIKey | RNXFBNFDBKPAIH-PSEOFWMXSA-N |
| XLogP | 2.38 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |