C19H26O3 — CID 23248860
methyl 1,3-dibutyl-1H-isochromene-4-carboxylate (PubChem CID 23248860) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is methyl 1,3-dibutyl-1H-isochromene-4-carboxylate.
| Compound Name | methyl 1,3-dibutyl-1H-isochromene-4-carboxylate |
|---|---|
| PubChem CID | 23248860 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | methyl 1,3-dibutyl-1H-isochromene-4-carboxylate |
| SMILES | CCCCC1=C(C(=O)OC)c2ccccc2C(CCCC)O1 |
| InChI | InChI=1S/C19H26O3/c1-4-6-12-16-14-10-8-9-11-15(14)18(19(20)21-3)17(22-16)13-7-5-2/h8-11,16H,4-7,12-13H2,1-3H3 |
| InChIKey | QAAXDLDOEQBAOQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |