C17H27NO4 — CID 23248959
3-[5-butyl-2-(methoxymethoxy)phenyl]-3-hydroxy-N,N-dimethylpropanamide (PubChem CID 23248959) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is 3-[5-butyl-2-(methoxymethoxy)phenyl]-3-hydroxy-N,N-dimethylpropanamide.
| Compound Name | 3-[5-butyl-2-(methoxymethoxy)phenyl]-3-hydroxy-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 23248959 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 3-[5-butyl-2-(methoxymethoxy)phenyl]-3-hydroxy-N,N-dimethylpropanamide |
| SMILES | CCCCc1ccc(OCOC)c(C(O)CC(=O)N(C)C)c1 |
| InChI | InChI=1S/C17H27NO4/c1-5-6-7-13-8-9-16(22-12-21-4)14(10-13)15(19)11-17(20)18(2)3/h8-10,15,19H,5-7,11-12H2,1-4H3 |
| InChIKey | FEDUBCRLAIEQPU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|