About [4-[ethyl(1-hydroxyethyl)amino]-4-oxobutan-2-yl] 4-butylbenzoate
[4-[ethyl(1-hydroxyethyl)amino]-4-oxobutan-2-yl] 4-butylbenzoate (PubChem CID 142769822) has the molecular formula C19H29NO4
and a molecular weight of 335.44 g/mol. Its IUPAC name is [4-[ethyl(1-hydroxyethyl)amino]-4-oxobutan-2-yl] 4-butylbenzoate.
Molecular Properties
| Compound Name | [4-[ethyl(1-hydroxyethyl)amino]-4-oxobutan-2-yl] 4-butylbenzoate |
| PubChem CID | 142769822 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | [4-[ethyl(1-hydroxyethyl)amino]-4-oxobutan-2-yl] 4-butylbenzoate |
| SMILES | CCCCc1ccc(C(=O)OC(C)CC(=O)N(CC)C(C)O)cc1 |
| InChI | InChI=1S/C19H29NO4/c1-5-7-8-16-9-11-17(12-10-16)19(23)24-14(3)13-18(22)20(6-2)15(4)21/h9-12,14-15,21H,5-8,13H2,1-4H3 |
| InChIKey | HZXNPOVIIBPYGM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [4-[ethyl(1-hydroxyethyl)amino]-4-oxobutan-2-yl] 4-butylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[ethyl(1-hydroxyethyl)amino]-4-oxobutan-2-yl] 4-butylbenzoate?
The IUPAC name of [4-[ethyl(1-hydroxyethyl)amino]-4-oxobutan-2-yl] 4-butylbenzoate (CID 142769822) is [4-[ethyl(1-hydroxyethyl)amino]-4-oxobutan-2-yl] 4-butylbenzoate.
What is the SMILES notation for [4-[ethyl(1-hydroxyethyl)amino]-4-oxobutan-2-yl] 4-butylbenzoate?
The canonical SMILES for [4-[ethyl(1-hydroxyethyl)amino]-4-oxobutan-2-yl] 4-butylbenzoate is CCCCc1ccc(C(=O)OC(C)CC(=O)N(CC)C(C)O)cc1.
What is the InChIKey of [4-[ethyl(1-hydroxyethyl)amino]-4-oxobutan-2-yl] 4-butylbenzoate?
The InChIKey is HZXNPOVIIBPYGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29NO4/c1-5-7-8-16-9-11-17(12-10-16)19(23)24-14(3)13-18(22)20(6-2)15(4)21/h9-12,14-15,21H,5-8,13H2,1-4H3.
What are the key properties of [4-[ethyl(1-hydroxyethyl)amino]-4-oxobutan-2-yl] 4-butylbenzoate?
[4-[ethyl(1-hydroxyethyl)amino]-4-oxobutan-2-yl] 4-butylbenzoate has a molecular weight of 335.44 g/mol, XLogP of 3.15, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[ethyl(1-hydroxyethyl)amino]-4-oxobutan-2-yl] 4-butylbenzoate is sourced from PubChem (CID 142769822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).