C23H23N2OP — CID 23249038
[6-(4-ethyl-4,5-dihydro-1,3-oxazol-2-yl)-2-pyridinyl]methyl-diphenylphosphane (PubChem CID 23249038) has the molecular formula C23H23N2OP and a molecular weight of 374.42 g/mol. Its IUPAC name is [6-(4-ethyl-4,5-dihydro-1,3-oxazol-2-yl)-2-pyridinyl]methyl-diphenylphosphane.
| Compound Name | [6-(4-ethyl-4,5-dihydro-1,3-oxazol-2-yl)-2-pyridinyl]methyl-diphenylphosphane |
|---|---|
| PubChem CID | 23249038 |
| Molecular Formula | C23H23N2OP |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | [6-(4-ethyl-4,5-dihydro-1,3-oxazol-2-yl)-2-pyridinyl]methyl-diphenylphosphane |
| SMILES | CCC1COC(c2cccc(CP(c3ccccc3)c3ccccc3)n2)=N1 |
| InChI | InChI=1S/C23H23N2OP/c1-2-18-16-26-23(25-18)22-15-9-10-19(24-22)17-27(20-11-5-3-6-12-20)21-13-7-4-8-14-21/h3-15,18H,2,16-17H2,1H3 |
| InChIKey | ZISAIBRPBSTRPQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|