C25H24Cl6N2O11 — CID 23253141
[(3aR,4R,6S,6aS,9bS)-6,9-dimethyl-3-methylidene-2,8-dioxo-6,6a-bis[(2,2,2-trichloroacetyl)carbamoyloxy]-4,5,7,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl] 2-methylpropanoate (PubChem CID 23253141) has the molecular formula C25H24Cl6N2O11 and a molecular weight of 741.19 g/mol. Its IUPAC name is [(3aR,4R,6S,6aS,9bS)-6,9-dimethyl-3-methylidene-2,8-dioxo-6,6a-bis[(2,2,2-trichloroacetyl)carbamoyloxy]-4,5,7,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl] 2-methylpropanoate.
| Compound Name | [(3aR,4R,6S,6aS,9bS)-6,9-dimethyl-3-methylidene-2,8-dioxo-6,6a-bis[(2,2,2-trichloroacetyl)carbamoyloxy]-4,5,7,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 23253141 |
| Molecular Formula | C25H24Cl6N2O11 |
| Molecular Weight | 741.19 g/mol |
| Exact Mass | 737.95 |
| IUPAC Name | [(3aR,4R,6S,6aS,9bS)-6,9-dimethyl-3-methylidene-2,8-dioxo-6,6a-bis[(2,2,2-trichloroacetyl)carbamoyloxy]-4,5,7,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl] 2-methylpropanoate |
| SMILES | C=C1C(=O)O[C@@H]2C3=C(C)C(=O)C[C@@]3(OC(=O)NC(=O)C(Cl)(Cl)Cl)[C@@](C)(OC(=O)NC(=O)C(Cl)(Cl)Cl)C[C@@H](OC(=O)C(C)C)[C@@H]12 |
| InChI | InChI=1S/C25H24Cl6N2O11/c1-8(2)16(35)41-12-7-22(5,43-20(39)32-18(37)24(26,27)28)23(44-21(40)33-19(38)25(29,30)31)6-11(34)9(3)14(23)15-13(12)10(4)17(36)42-15/h8,12-13,15H,4,6-7H2,1-3,5H3,(H,32,37,39)(H,33,38,40)/t12-,13-,15+,22+,23+/m1/s1 |
| InChIKey | KUFNVMZTBCZOHX-VYZZKTBBSA-N |
| XLogP | 4.09 |
| TPSA | 180.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.19 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|