C16H24O4 — CID 23253272
methyl (2R)-2-[(2S,3S,6R)-3,9-dimethyl-5-methylidene-1,7-dioxaspiro[5.5]undec-8-en-2-yl]propanoate (PubChem CID 23253272) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is methyl (2R)-2-[(2S,3S,6R)-3,9-dimethyl-5-methylidene-1,7-dioxaspiro[5.5]undec-8-en-2-yl]propanoate.
| Compound Name | methyl (2R)-2-[(2S,3S,6R)-3,9-dimethyl-5-methylidene-1,7-dioxaspiro[5.5]undec-8-en-2-yl]propanoate |
|---|---|
| PubChem CID | 23253272 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | methyl (2R)-2-[(2S,3S,6R)-3,9-dimethyl-5-methylidene-1,7-dioxaspiro[5.5]undec-8-en-2-yl]propanoate |
| SMILES | C=C1C[C@H](C)[C@@H]([C@@H](C)C(=O)OC)O[C@@]12CCC(C)=CO2 |
| InChI | InChI=1S/C16H24O4/c1-10-6-7-16(19-9-10)12(3)8-11(2)14(20-16)13(4)15(17)18-5/h9,11,13-14H,3,6-8H2,1-2,4-5H3/t11-,13+,14-,16-/m0/s1 |
| InChIKey | IRAZNYXISGDSKO-AEIGPULVSA-N |
| XLogP | 3.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|