C17H26O4 — CID 23253669
[(2Z,3R,3aS,4S,6S,7aS)-3-hydroxy-3,6-dimethyl-2-(3-methylbut-2-enylidene)-3a,4,5,6,7,7a-hexahydro-1-benzofuran-4-yl] acetate (PubChem CID 23253669) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is [(2Z,3R,3aS,4S,6S,7aS)-3-hydroxy-3,6-dimethyl-2-(3-methylbut-2-enylidene)-3a,4,5,6,7,7a-hexahydro-1-benzofuran-4-yl] acetate.
| Compound Name | [(2Z,3R,3aS,4S,6S,7aS)-3-hydroxy-3,6-dimethyl-2-(3-methylbut-2-enylidene)-3a,4,5,6,7,7a-hexahydro-1-benzofuran-4-yl] acetate |
|---|---|
| PubChem CID | 23253669 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | [(2Z,3R,3aS,4S,6S,7aS)-3-hydroxy-3,6-dimethyl-2-(3-methylbut-2-enylidene)-3a,4,5,6,7,7a-hexahydro-1-benzofuran-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H](C)C[C@@H]2O/C(=C\C=C(C)C)[C@](C)(O)[C@H]12 |
| InChI | InChI=1S/C17H26O4/c1-10(2)6-7-15-17(5,19)16-13(20-12(4)18)8-11(3)9-14(16)21-15/h6-7,11,13-14,16,19H,8-9H2,1-5H3/b15-7-/t11-,13+,14+,16-,17+/m1/s1 |
| InChIKey | LZHNJRCZLXOMBQ-AOYZYHFZSA-N |
| XLogP | 2.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |