C11H14O4S — CID 23256646
(2R,5R)-2-(benzenesulfonyl)-5-methoxyoxolane (PubChem CID 23256646) has the molecular formula C11H14O4S and a molecular weight of 242.30 g/mol. Its IUPAC name is (2R,5R)-2-(benzenesulfonyl)-5-methoxyoxolane.
| Compound Name | (2R,5R)-2-(benzenesulfonyl)-5-methoxyoxolane |
|---|---|
| PubChem CID | 23256646 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | (2R,5R)-2-(benzenesulfonyl)-5-methoxyoxolane |
| SMILES | CO[C@H]1CC[C@@H](S(=O)(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C11H14O4S/c1-14-10-7-8-11(15-10)16(12,13)9-5-3-2-4-6-9/h2-6,10-11H,7-8H2,1H3/t10-,11-/m1/s1 |
| InChIKey | DLWUDIYDJNXNNF-GHMZBOCLSA-N |
| XLogP | 1.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |