C22H22N2O7 — CID 23257937
2-O-ethyl 5-O,6-O-dimethyl 7-(4-methoxyphenyl)-3-methylimidazo[1,2-a]pyridine-2,5,6-tricarboxylate (PubChem CID 23257937) has the molecular formula C22H22N2O7 and a molecular weight of 426.43 g/mol. Its IUPAC name is 2-O-ethyl 5-O,6-O-dimethyl 7-(4-methoxyphenyl)-3-methylimidazo[1,2-a]pyridine-2,5,6-tricarboxylate.
| Compound Name | 2-O-ethyl 5-O,6-O-dimethyl 7-(4-methoxyphenyl)-3-methylimidazo[1,2-a]pyridine-2,5,6-tricarboxylate |
|---|---|
| PubChem CID | 23257937 |
| Molecular Formula | C22H22N2O7 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 2-O-ethyl 5-O,6-O-dimethyl 7-(4-methoxyphenyl)-3-methylimidazo[1,2-a]pyridine-2,5,6-tricarboxylate |
| SMILES | CCOC(=O)c1nc2cc(-c3ccc(OC)cc3)c(C(=O)OC)c(C(=O)OC)n2c1C |
| InChI | InChI=1S/C22H22N2O7/c1-6-31-21(26)18-12(2)24-16(23-18)11-15(13-7-9-14(28-3)10-8-13)17(20(25)29-4)19(24)22(27)30-5/h7-11H,6H2,1-5H3 |
| InChIKey | YHGJAHTVBRSLMS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 105.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|