C12H17NO — CID 23258024
(2E)-13-azabicyclo[10.1.0]trideca-2,12-dien-4-one (PubChem CID 23258024) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (2E)-13-azabicyclo[10.1.0]trideca-2,12-dien-4-one.
| Compound Name | (2E)-13-azabicyclo[10.1.0]trideca-2,12-dien-4-one |
|---|---|
| PubChem CID | 23258024 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (2E)-13-azabicyclo[10.1.0]trideca-2,12-dien-4-one |
| SMILES | O=C1/C=C/C2N=C2CCCCCCC1 |
| InChI | InChI=1S/C12H17NO/c14-10-6-4-2-1-3-5-7-11-12(13-11)9-8-10/h8-9,12H,1-7H2/b9-8+ |
| InChIKey | HABHQYHUVZHTJG-CMDGGOBGSA-N |
| XLogP | 2.68 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |