C14H21NO — CID 23258025
(2E)-15-azabicyclo[12.1.0]pentadeca-2,14-dien-4-one (PubChem CID 23258025) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is (2E)-15-azabicyclo[12.1.0]pentadeca-2,14-dien-4-one.
| Compound Name | (2E)-15-azabicyclo[12.1.0]pentadeca-2,14-dien-4-one |
|---|---|
| PubChem CID | 23258025 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | (2E)-15-azabicyclo[12.1.0]pentadeca-2,14-dien-4-one |
| SMILES | O=C1/C=C/C2N=C2CCCCCCCCC1 |
| InChI | InChI=1S/C14H21NO/c16-12-8-6-4-2-1-3-5-7-9-13-14(15-13)11-10-12/h10-11,14H,1-9H2/b11-10+ |
| InChIKey | MWHNXMIMJYEWLR-ZHACJKMWSA-N |
| XLogP | 3.46 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |