C11H6N6 — CID 23258943
3-phenyltriazolo[4,5-d]pyrimidine-5-carbonitrile (PubChem CID 23258943) has the molecular formula C11H6N6 and a molecular weight of 222.21 g/mol. Its IUPAC name is 3-phenyltriazolo[4,5-d]pyrimidine-5-carbonitrile.
| Compound Name | 3-phenyltriazolo[4,5-d]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 23258943 |
| Molecular Formula | C11H6N6 |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 3-phenyltriazolo[4,5-d]pyrimidine-5-carbonitrile |
| SMILES | N#Cc1ncc2nnn(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C11H6N6/c12-6-10-13-7-9-11(14-10)17(16-15-9)8-4-2-1-3-5-8/h1-5,7H |
| InChIKey | SBAWJYBJDPWANB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |