C9H9NO2S2 — CID 23259578
methyl 4-isothiocyanato-2,5-dimethylthiophene-3-carboxylate (PubChem CID 23259578) has the molecular formula C9H9NO2S2 and a molecular weight of 227.31 g/mol. Its IUPAC name is methyl 4-isothiocyanato-2,5-dimethylthiophene-3-carboxylate.
| Compound Name | methyl 4-isothiocyanato-2,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 23259578 |
| Molecular Formula | C9H9NO2S2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.01 |
| IUPAC Name | methyl 4-isothiocyanato-2,5-dimethylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(C)sc(C)c1N=C=S |
| InChI | InChI=1S/C9H9NO2S2/c1-5-7(9(11)12-3)8(10-4-13)6(2)14-5/h1-3H3 |
| InChIKey | SFRDXLJQPCTEQJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|