methyl 4-isothiocyanato-2,5-dimethylthiophene-3-carboxylate

C9H9NO2S2 — CID 23259578

IUPACmethyl 4-isothiocyanato-2,5-dimethylthiophene-3-carboxylate
SMILESCOC(=O)c1c(C)sc(C)c1N=C=S
InChIInChI=1S/C9H9NO2S2/c1-5-7(9(11)12-3)8(10-4-13)6(2)14-5/h1-3H3
InChIKeySFRDXLJQPCTEQJ-UHFFFAOYSA-N
MW227.31 g/mol
LogP2.89
Rot. Bonds2

About methyl 4-isothiocyanato-2,5-dimethylthiophene-3-carboxylate

methyl 4-isothiocyanato-2,5-dimethylthiophene-3-carboxylate (PubChem CID 23259578) has the molecular formula C9H9NO2S2 and a molecular weight of 227.31 g/mol. Its IUPAC name is methyl 4-isothiocyanato-2,5-dimethylthiophene-3-carboxylate.

Molecular Properties

Compound Namemethyl 4-isothiocyanato-2,5-dimethylthiophene-3-carboxylate
PubChem CID23259578
Molecular FormulaC9H9NO2S2
Molecular Weight227.31 g/mol
Exact Mass227.01
IUPAC Namemethyl 4-isothiocyanato-2,5-dimethylthiophene-3-carboxylate
SMILESCOC(=O)c1c(C)sc(C)c1N=C=S
InChIInChI=1S/C9H9NO2S2/c1-5-7(9(11)12-3)8(10-4-13)6(2)14-5/h1-3H3
InChIKeySFRDXLJQPCTEQJ-UHFFFAOYSA-N
XLogP2.89
TPSA38.66 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.31
LogP ≤ 52.89
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}

Analyze methyl 4-isothiocyanato-2,5-dimethylthiophene-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-isothiocyanato-2,5-dimethylthiophene-3-carboxylate?
The IUPAC name of methyl 4-isothiocyanato-2,5-dimethylthiophene-3-carboxylate (CID 23259578) is methyl 4-isothiocyanato-2,5-dimethylthiophene-3-carboxylate.
What is the SMILES notation for methyl 4-isothiocyanato-2,5-dimethylthiophene-3-carboxylate?
The canonical SMILES for methyl 4-isothiocyanato-2,5-dimethylthiophene-3-carboxylate is COC(=O)c1c(C)sc(C)c1N=C=S.
What is the InChIKey of methyl 4-isothiocyanato-2,5-dimethylthiophene-3-carboxylate?
The InChIKey is SFRDXLJQPCTEQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2S2/c1-5-7(9(11)12-3)8(10-4-13)6(2)14-5/h1-3H3.
What are the key properties of methyl 4-isothiocyanato-2,5-dimethylthiophene-3-carboxylate?
methyl 4-isothiocyanato-2,5-dimethylthiophene-3-carboxylate has a molecular weight of 227.31 g/mol, XLogP of 2.89, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-isothiocyanato-2,5-dimethylthiophene-3-carboxylate is sourced from PubChem (CID 23259578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).