C9H12NO4S+ — CID 58022290
[4,5-bis(methoxycarbonyl)-2-methylthiophen-3-yl]azanium (PubChem CID 58022290) has the molecular formula C9H12NO4S+ and a molecular weight of 230.26 g/mol. Its IUPAC name is [4,5-bis(methoxycarbonyl)-2-methylthiophen-3-yl]azanium.
| Compound Name | [4,5-bis(methoxycarbonyl)-2-methylthiophen-3-yl]azanium |
|---|---|
| PubChem CID | 58022290 |
| Molecular Formula | C9H12NO4S+ |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | [4,5-bis(methoxycarbonyl)-2-methylthiophen-3-yl]azanium |
| SMILES | COC(=O)c1sc(C)c([NH3+])c1C(=O)OC |
| InChI | InChI=1S/C9H11NO4S/c1-4-6(10)5(8(11)13-2)7(15-4)9(12)14-3/h10H2,1-3H3/p+1 |
| InChIKey | GUCQCGOEJUBZOG-UHFFFAOYSA-O |
| XLogP | 0.50 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |